C21H30O5 — CID 23069385
phenyl-(4,6,6-trihydroxy-4-octoxycyclohex-2-en-1-yl)methanone (PubChem CID 23069385) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is phenyl-(4,6,6-trihydroxy-4-octoxycyclohex-2-en-1-yl)methanone.
| Compound Name | phenyl-(4,6,6-trihydroxy-4-octoxycyclohex-2-en-1-yl)methanone |
|---|---|
| PubChem CID | 23069385 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | phenyl-(4,6,6-trihydroxy-4-octoxycyclohex-2-en-1-yl)methanone |
| SMILES | CCCCCCCCOC1(O)C=CC(C(=O)c2ccccc2)C(O)(O)C1 |
| InChI | InChI=1S/C21H30O5/c1-2-3-4-5-6-10-15-26-20(23)14-13-18(21(24,25)16-20)19(22)17-11-8-7-9-12-17/h7-9,11-14,18,23-25H,2-6,10,15-16H2,1H3 |
| InChIKey | NUNZEHSTWPYZOR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|