C23H34O3 — CID 101432574
1-[(1R,2S,3S)-2-benzoyl-3-hydroxy-3-methylcyclohexyl]nonan-1-one (PubChem CID 101432574) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 1-[(1R,2S,3S)-2-benzoyl-3-hydroxy-3-methylcyclohexyl]nonan-1-one.
| Compound Name | 1-[(1R,2S,3S)-2-benzoyl-3-hydroxy-3-methylcyclohexyl]nonan-1-one |
|---|---|
| PubChem CID | 101432574 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1-[(1R,2S,3S)-2-benzoyl-3-hydroxy-3-methylcyclohexyl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)[C@@H]1CCC[C@](C)(O)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H34O3/c1-3-4-5-6-7-11-16-20(24)19-15-12-17-23(2,26)21(19)22(25)18-13-9-8-10-14-18/h8-10,13-14,19,21,26H,3-7,11-12,15-17H2,1-2H3/t19-,21+,23-/m0/s1 |
| InChIKey | PFHGKYGKBVFAND-WPYKKVEZSA-N |
| XLogP | 5.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|