C20H28N2O2 — CID 70173104
1-octoxy-4-phenyldiazenylcyclohexa-2,4-dien-1-ol (PubChem CID 70173104) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-octoxy-4-phenyldiazenylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1-octoxy-4-phenyldiazenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 70173104 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-octoxy-4-phenyldiazenylcyclohexa-2,4-dien-1-ol |
| SMILES | CCCCCCCCOC1(O)C=CC(/N=N/c2ccccc2)=CC1 |
| InChI | InChI=1S/C20H28N2O2/c1-2-3-4-5-6-10-17-24-20(23)15-13-19(14-16-20)22-21-18-11-8-7-9-12-18/h7-9,11-15,23H,2-6,10,16-17H2,1H3/b22-21+ |
| InChIKey | QXHUUMDLOVFKLI-QURGRASLSA-N |
| XLogP | 5.68 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|