C18H23NO2 — CID 70389547
N-(4-butoxy-4-methoxycyclohexa-1,5-dien-1-yl)-1-phenylmethanimine (PubChem CID 70389547) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(4-butoxy-4-methoxycyclohexa-1,5-dien-1-yl)-1-phenylmethanimine.
| Compound Name | N-(4-butoxy-4-methoxycyclohexa-1,5-dien-1-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 70389547 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-(4-butoxy-4-methoxycyclohexa-1,5-dien-1-yl)-1-phenylmethanimine |
| SMILES | CCCCOC1(OC)C=CC(/N=C/c2ccccc2)=CC1 |
| InChI | InChI=1S/C18H23NO2/c1-3-4-14-21-18(20-2)12-10-17(11-13-18)19-15-16-8-6-5-7-9-16/h5-12,15H,3-4,13-14H2,1-2H3/b19-15+ |
| InChIKey | UJVMVLPLDMRLBQ-XDJHFCHBSA-N |
| XLogP | 4.11 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|