C20H25NO3 — CID 154130220
2-(4-amino-4-butoxycyclohexa-1,5-dien-1-yl)-4-phenylbut-3-enoic acid (PubChem CID 154130220) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-(4-amino-4-butoxycyclohexa-1,5-dien-1-yl)-4-phenylbut-3-enoic acid.
| Compound Name | 2-(4-amino-4-butoxycyclohexa-1,5-dien-1-yl)-4-phenylbut-3-enoic acid |
|---|---|
| PubChem CID | 154130220 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-(4-amino-4-butoxycyclohexa-1,5-dien-1-yl)-4-phenylbut-3-enoic acid |
| SMILES | CCCCOC1(N)C=CC(C(C=Cc2ccccc2)C(=O)O)=CC1 |
| InChI | InChI=1S/C20H25NO3/c1-2-3-15-24-20(21)13-11-17(12-14-20)18(19(22)23)10-9-16-7-5-4-6-8-16/h4-13,18H,2-3,14-15,21H2,1H3,(H,22,23) |
| InChIKey | XJSUBFDOLJKMNY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|