C26H32O4 — CID 11165724
diethyl 2-butyl-2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate (PubChem CID 11165724) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is diethyl 2-butyl-2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate.
| Compound Name | diethyl 2-butyl-2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 11165724 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | diethyl 2-butyl-2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate |
| SMILES | CCCCC(C(=O)OCC)(C(=O)OCC)[C@H](/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32O4/c1-4-7-20-26(24(27)29-5-2,25(28)30-6-3)23(22-16-12-9-13-17-22)19-18-21-14-10-8-11-15-21/h8-19,23H,4-7,20H2,1-3H3/b19-18+/t23-/m1/s1 |
| InChIKey | NIUZURQXCSHBMB-KIYMODEPSA-N |
| XLogP | 5.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|