About [(2Z)-2-benzylideneheptyl] 3-methylbutanoate
[(2Z)-2-benzylideneheptyl] 3-methylbutanoate (PubChem CID 6435835) has the molecular formula C19H28O2
and a molecular weight of 288.43 g/mol. Its IUPAC name is [(2Z)-2-benzylideneheptyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [(2Z)-2-benzylideneheptyl] 3-methylbutanoate |
| PubChem CID | 6435835 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [(2Z)-2-benzylideneheptyl] 3-methylbutanoate |
| SMILES | CCCCC/C(=C/c1ccccc1)COC(=O)CC(C)C |
| InChI | InChI=1S/C19H28O2/c1-4-5-7-12-18(14-17-10-8-6-9-11-17)15-21-19(20)13-16(2)3/h6,8-11,14,16H,4-5,7,12-13,15H2,1-3H3/b18-14- |
| InChIKey | RNKTVAMGERKTEZ-JXAWBTAJSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-2-benzylideneheptyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-2-benzylideneheptyl] 3-methylbutanoate?
The IUPAC name of [(2Z)-2-benzylideneheptyl] 3-methylbutanoate (CID 6435835) is [(2Z)-2-benzylideneheptyl] 3-methylbutanoate.
What is the SMILES notation for [(2Z)-2-benzylideneheptyl] 3-methylbutanoate?
The canonical SMILES for [(2Z)-2-benzylideneheptyl] 3-methylbutanoate is CCCCC/C(=C/c1ccccc1)COC(=O)CC(C)C.
What is the InChIKey of [(2Z)-2-benzylideneheptyl] 3-methylbutanoate?
The InChIKey is RNKTVAMGERKTEZ-JXAWBTAJSA-N. The full InChI is InChI=1S/C19H28O2/c1-4-5-7-12-18(14-17-10-8-6-9-11-17)15-21-19(20)13-16(2)3/h6,8-11,14,16H,4-5,7,12-13,15H2,1-3H3/b18-14-.
What are the key properties of [(2Z)-2-benzylideneheptyl] 3-methylbutanoate?
[(2Z)-2-benzylideneheptyl] 3-methylbutanoate has a molecular weight of 288.43 g/mol, XLogP of 5.24, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-benzylideneheptyl] 3-methylbutanoate is sourced from PubChem (CID 6435835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).