About 3-benzylideneoctanoate
3-benzylideneoctanoate (PubChem CID 20981574) has the molecular formula C15H19O2-
and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-benzylideneoctanoate.
Molecular Properties
| Compound Name | 3-benzylideneoctanoate |
| PubChem CID | 20981574 |
| Molecular Formula | C15H19O2- |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-benzylideneoctanoate |
| SMILES | CCCCCC(=Cc1ccccc1)CC(=O)[O-] |
| InChI | InChI=1S/C15H20O2/c1-2-3-5-10-14(12-15(16)17)11-13-8-6-4-7-9-13/h4,6-9,11H,2-3,5,10,12H2,1H3,(H,16,17)/p-1 |
| InChIKey | SBKSKVXAXJYKHH-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-benzylideneoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylideneoctanoate?
The IUPAC name of 3-benzylideneoctanoate (CID 20981574) is 3-benzylideneoctanoate.
What is the SMILES notation for 3-benzylideneoctanoate?
The canonical SMILES for 3-benzylideneoctanoate is CCCCCC(=Cc1ccccc1)CC(=O)[O-].
What is the InChIKey of 3-benzylideneoctanoate?
The InChIKey is SBKSKVXAXJYKHH-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H20O2/c1-2-3-5-10-14(12-15(16)17)11-13-8-6-4-7-9-13/h4,6-9,11H,2-3,5,10,12H2,1H3,(H,16,17)/p-1.
What are the key properties of 3-benzylideneoctanoate?
3-benzylideneoctanoate has a molecular weight of 231.32 g/mol, XLogP of 2.79, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylideneoctanoate is sourced from PubChem (CID 20981574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).