C17H19BrO2 — CID 67904983
butyl 1-bromo-4-phenylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 67904983) has the molecular formula C17H19BrO2 and a molecular weight of 335.24 g/mol. Its IUPAC name is butyl 1-bromo-4-phenylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | butyl 1-bromo-4-phenylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 67904983 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | butyl 1-bromo-4-phenylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCCCOC(=O)C1(Br)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C17H19BrO2/c1-2-3-13-20-16(19)17(18)11-9-15(10-12-17)14-7-5-4-6-8-14/h4-11H,2-3,12-13H2,1H3 |
| InChIKey | LVWRQWXBPKNEQY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|