C25H39N3O — CID 174814941
1-butyl-N-methyl-N-(2-methylheptan-2-yloxy)-4-phenyldiazenylcyclohexa-2,4-dien-1-amine (PubChem CID 174814941) has the molecular formula C25H39N3O and a molecular weight of 397.61 g/mol. Its IUPAC name is 1-butyl-N-methyl-N-(2-methylheptan-2-yloxy)-4-phenyldiazenylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1-butyl-N-methyl-N-(2-methylheptan-2-yloxy)-4-phenyldiazenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 174814941 |
| Molecular Formula | C25H39N3O |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | 1-butyl-N-methyl-N-(2-methylheptan-2-yloxy)-4-phenyldiazenylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCCCC(C)(C)ON(C)C1(CCCC)C=CC(/N=N/c2ccccc2)=CC1 |
| InChI | InChI=1S/C25H39N3O/c1-6-8-13-18-24(3,4)29-28(5)25(19-9-7-2)20-16-23(17-21-25)27-26-22-14-11-10-12-15-22/h10-12,14-17,20H,6-9,13,18-19,21H2,1-5H3/b27-26+ |
| InChIKey | MOGGFRKSHJPTGL-CYYJNZCTSA-N |
| XLogP | 7.77 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|