C18H20N2 — CID 166792193
[4,4-bis(prop-2-enyl)cyclohexa-1,5-dien-1-yl]-phenyldiazene (PubChem CID 166792193) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is [4,4-bis(prop-2-enyl)cyclohexa-1,5-dien-1-yl]-phenyldiazene.
| Compound Name | [4,4-bis(prop-2-enyl)cyclohexa-1,5-dien-1-yl]-phenyldiazene |
|---|---|
| PubChem CID | 166792193 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [4,4-bis(prop-2-enyl)cyclohexa-1,5-dien-1-yl]-phenyldiazene |
| SMILES | C=CCC1(CC=C)C=CC(/N=N/c2ccccc2)=CC1 |
| InChI | InChI=1S/C18H20N2/c1-3-12-18(13-4-2)14-10-17(11-15-18)20-19-16-8-6-5-7-9-16/h3-11,14H,1-2,12-13,15H2/b20-19+ |
| InChIKey | KWUAIWOWQUNVKY-FMQUCBEESA-N |
| XLogP | 5.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|