C25H31NO3 — CID 89246424
butyl (3R)-3-(benzhydrylideneamino)-1-(1-hydroxyethyl)cyclopentane-1-carboxylate (PubChem CID 89246424) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is butyl (3R)-3-(benzhydrylideneamino)-1-(1-hydroxyethyl)cyclopentane-1-carboxylate.
| Compound Name | butyl (3R)-3-(benzhydrylideneamino)-1-(1-hydroxyethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 89246424 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | butyl (3R)-3-(benzhydrylideneamino)-1-(1-hydroxyethyl)cyclopentane-1-carboxylate |
| SMILES | CCCCOC(=O)C1(C(C)O)CC[C@@H](N=C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H31NO3/c1-3-4-17-29-24(28)25(19(2)27)16-15-22(18-25)26-23(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22,27H,3-4,15-18H2,1-2H3/t19?,22-,25?/m1/s1 |
| InChIKey | KAVRSOILLXHXDM-WRVMZKTCSA-N |
| XLogP | 4.79 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|