C20H17FN2O — CID 155435961
N-(5-fluoro-6-methoxy-2-methyl-3-pyridinyl)-1,1-diphenylmethanimine (PubChem CID 155435961) has the molecular formula C20H17FN2O and a molecular weight of 320.37 g/mol. Its IUPAC name is N-(5-fluoro-6-methoxy-2-methyl-3-pyridinyl)-1,1-diphenylmethanimine.
| Compound Name | N-(5-fluoro-6-methoxy-2-methyl-3-pyridinyl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 155435961 |
| Molecular Formula | C20H17FN2O |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(5-fluoro-6-methoxy-2-methyl-3-pyridinyl)-1,1-diphenylmethanimine |
| SMILES | COc1nc(C)c(N=C(c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C20H17FN2O/c1-14-18(13-17(21)20(22-14)24-2)23-19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13H,1-2H3 |
| InChIKey | AYQMLZMDWWRDOY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|