C26H26FNO2 — CID 167519138
methyl 2-[4-(benzhydrylideneamino)-6-fluoro-2,3-dimethylphenyl]butanoate (PubChem CID 167519138) has the molecular formula C26H26FNO2 and a molecular weight of 403.50 g/mol. Its IUPAC name is methyl 2-[4-(benzhydrylideneamino)-6-fluoro-2,3-dimethylphenyl]butanoate.
| Compound Name | methyl 2-[4-(benzhydrylideneamino)-6-fluoro-2,3-dimethylphenyl]butanoate |
|---|---|
| PubChem CID | 167519138 |
| Molecular Formula | C26H26FNO2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | methyl 2-[4-(benzhydrylideneamino)-6-fluoro-2,3-dimethylphenyl]butanoate |
| SMILES | CCC(C(=O)OC)c1c(F)cc(N=C(c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C26H26FNO2/c1-5-21(26(29)30-4)24-18(3)17(2)23(16-22(24)27)28-25(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-16,21H,5H2,1-4H3 |
| InChIKey | OVJBTWLZCZHKMH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|