About 2-chloro-5-methoxy-1,8-naphthyridine
2-chloro-5-methoxy-1,8-naphthyridine (PubChem CID 84665756) has the molecular formula C9H7ClN2O
and a molecular weight of 194.62 g/mol. Its IUPAC name is 2-chloro-5-methoxy-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-chloro-5-methoxy-1,8-naphthyridine |
| PubChem CID | 84665756 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 2-chloro-5-methoxy-1,8-naphthyridine |
| SMILES | COc1ccnc2nc(Cl)ccc12 |
| InChI | InChI=1S/C9H7ClN2O/c1-13-7-4-5-11-9-6(7)2-3-8(10)12-9/h2-5H,1H3 |
| InChIKey | PECOTGKFWXKSNH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-methoxy-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methoxy-1,8-naphthyridine?
The IUPAC name of 2-chloro-5-methoxy-1,8-naphthyridine (CID 84665756) is 2-chloro-5-methoxy-1,8-naphthyridine.
What is the SMILES notation for 2-chloro-5-methoxy-1,8-naphthyridine?
The canonical SMILES for 2-chloro-5-methoxy-1,8-naphthyridine is COc1ccnc2nc(Cl)ccc12.
What is the InChIKey of 2-chloro-5-methoxy-1,8-naphthyridine?
The InChIKey is PECOTGKFWXKSNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O/c1-13-7-4-5-11-9-6(7)2-3-8(10)12-9/h2-5H,1H3.
What are the key properties of 2-chloro-5-methoxy-1,8-naphthyridine?
2-chloro-5-methoxy-1,8-naphthyridine has a molecular weight of 194.62 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methoxy-1,8-naphthyridine is sourced from PubChem (CID 84665756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).