C7H8ClNO4S — CID 141469217
3,4-dimethoxypyridine-2-sulfonyl chloride (PubChem CID 141469217) has the molecular formula C7H8ClNO4S and a molecular weight of 237.66 g/mol. Its IUPAC name is 3,4-dimethoxypyridine-2-sulfonyl chloride.
| Compound Name | 3,4-dimethoxypyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 141469217 |
| Molecular Formula | C7H8ClNO4S |
| Molecular Weight | 237.66 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 3,4-dimethoxypyridine-2-sulfonyl chloride |
| SMILES | COc1ccnc(S(=O)(=O)Cl)c1OC |
| InChI | InChI=1S/C7H8ClNO4S/c1-12-5-3-4-9-7(6(5)13-2)14(8,10)11/h3-4H,1-2H3 |
| InChIKey | JHMZBZXAHMWRAZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.66 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |