C13H14ClNO3S — CID 106540316
1-(3-chloropropylsulfonyl)-5-methoxyisoquinoline (PubChem CID 106540316) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-(3-chloropropylsulfonyl)-5-methoxyisoquinoline.
| Compound Name | 1-(3-chloropropylsulfonyl)-5-methoxyisoquinoline |
|---|---|
| PubChem CID | 106540316 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-(3-chloropropylsulfonyl)-5-methoxyisoquinoline |
| SMILES | COc1cccc2c(S(=O)(=O)CCCCl)nccc12 |
| InChI | InChI=1S/C13H14ClNO3S/c1-18-12-5-2-4-11-10(12)6-8-15-13(11)19(16,17)9-3-7-14/h2,4-6,8H,3,7,9H2,1H3 |
| InChIKey | YWHSXCIHSRAURB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|