About 2-chloro-5,6-dimethoxyquinoline
2-chloro-5,6-dimethoxyquinoline (PubChem CID 146155196) has the molecular formula C11H10ClNO2
and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-chloro-5,6-dimethoxyquinoline.
Molecular Properties
| Compound Name | 2-chloro-5,6-dimethoxyquinoline |
| PubChem CID | 146155196 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 2-chloro-5,6-dimethoxyquinoline |
| SMILES | COc1ccc2nc(Cl)ccc2c1OC |
| InChI | InChI=1S/C11H10ClNO2/c1-14-9-5-4-8-7(11(9)15-2)3-6-10(12)13-8/h3-6H,1-2H3 |
| InChIKey | GJMJISROCJIBKU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5,6-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,6-dimethoxyquinoline?
The IUPAC name of 2-chloro-5,6-dimethoxyquinoline (CID 146155196) is 2-chloro-5,6-dimethoxyquinoline.
What is the SMILES notation for 2-chloro-5,6-dimethoxyquinoline?
The canonical SMILES for 2-chloro-5,6-dimethoxyquinoline is COc1ccc2nc(Cl)ccc2c1OC.
What is the InChIKey of 2-chloro-5,6-dimethoxyquinoline?
The InChIKey is GJMJISROCJIBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO2/c1-14-9-5-4-8-7(11(9)15-2)3-6-10(12)13-8/h3-6H,1-2H3.
What are the key properties of 2-chloro-5,6-dimethoxyquinoline?
2-chloro-5,6-dimethoxyquinoline has a molecular weight of 223.66 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,6-dimethoxyquinoline is sourced from PubChem (CID 146155196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).