C26H28N2O4S2 — CID 101498659
2-[2-[(5,6-dimethoxyquinolin-2-yl)methylsulfanyl]ethylsulfanylmethyl]-5,6-dimethoxyquinoline (PubChem CID 101498659) has the molecular formula C26H28N2O4S2 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[2-[(5,6-dimethoxyquinolin-2-yl)methylsulfanyl]ethylsulfanylmethyl]-5,6-dimethoxyquinoline.
| Compound Name | 2-[2-[(5,6-dimethoxyquinolin-2-yl)methylsulfanyl]ethylsulfanylmethyl]-5,6-dimethoxyquinoline |
|---|---|
| PubChem CID | 101498659 |
| Molecular Formula | C26H28N2O4S2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-[2-[(5,6-dimethoxyquinolin-2-yl)methylsulfanyl]ethylsulfanylmethyl]-5,6-dimethoxyquinoline |
| SMILES | COc1ccc2nc(CSCCSCc3ccc4c(OC)c(OC)ccc4n3)ccc2c1OC |
| InChI | InChI=1S/C26H28N2O4S2/c1-29-23-11-9-21-19(25(23)31-3)7-5-17(27-21)15-33-13-14-34-16-18-6-8-20-22(28-18)10-12-24(30-2)26(20)32-4/h5-12H,13-16H2,1-4H3 |
| InChIKey | ITYBFLOIIPKJCJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|