C17H20N2O3 — CID 3287826
1-phenyl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]methanamine (PubChem CID 3287826) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-phenyl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]methanamine.
| Compound Name | 1-phenyl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 3287826 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-phenyl-N-[(2,3,4-trimethoxyphenyl)methylideneamino]methanamine |
| SMILES | COc1ccc(C=NNCc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C17H20N2O3/c1-20-15-10-9-14(16(21-2)17(15)22-3)12-19-18-11-13-7-5-4-6-8-13/h4-10,12,18H,11H2,1-3H3 |
| InChIKey | ZCSHZFGDIWXATK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|