C16H16Cl2N2O2 — CID 110839822
N-[(3,5-dichloro-2,4-dimethoxyphenyl)methylideneamino]-1-phenylmethanamine (PubChem CID 110839822) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is N-[(3,5-dichloro-2,4-dimethoxyphenyl)methylideneamino]-1-phenylmethanamine.
| Compound Name | N-[(3,5-dichloro-2,4-dimethoxyphenyl)methylideneamino]-1-phenylmethanamine |
|---|---|
| PubChem CID | 110839822 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[(3,5-dichloro-2,4-dimethoxyphenyl)methylideneamino]-1-phenylmethanamine |
| SMILES | COc1c(Cl)cc(C=NNCc2ccccc2)c(OC)c1Cl |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-21-15-12(8-13(17)16(22-2)14(15)18)10-20-19-9-11-6-4-3-5-7-11/h3-8,10,19H,9H2,1-2H3 |
| InChIKey | PXWGGEHPOOTTLP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|