C16H17Br2ClN2O2 — CID 171436867
N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]-1-(4-methoxyphenyl)methanamine;hydrochloride (PubChem CID 171436867) has the molecular formula C16H17Br2ClN2O2 and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]-1-(4-methoxyphenyl)methanamine;hydrochloride.
| Compound Name | N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]-1-(4-methoxyphenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171436867 |
| Molecular Formula | C16H17Br2ClN2O2 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 461.93 |
| IUPAC Name | N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]-1-(4-methoxyphenyl)methanamine;hydrochloride |
| SMILES | COc1ccc(CN/N=C/c2ccc(Br)c(OC)c2Br)cc1.Cl |
| InChI | InChI=1S/C16H16Br2N2O2.ClH/c1-21-13-6-3-11(4-7-13)9-19-20-10-12-5-8-14(17)16(22-2)15(12)18;/h3-8,10,19H,9H2,1-2H3;1H/b20-10+; |
| InChIKey | NDJIAHFNEZZMPG-XZISABOOSA-N |
| XLogP | 4.77 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|