C16H15BrFN3OS — CID 9176236
1-[(Z)-(4-bromo-2-fluorophenyl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 9176236) has the molecular formula C16H15BrFN3OS and a molecular weight of 396.29 g/mol. Its IUPAC name is 1-[(Z)-(4-bromo-2-fluorophenyl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(Z)-(4-bromo-2-fluorophenyl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 9176236 |
| Molecular Formula | C16H15BrFN3OS |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 1-[(Z)-(4-bromo-2-fluorophenyl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)N/N=C\c2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C16H15BrFN3OS/c1-22-14-6-2-11(3-7-14)9-19-16(23)21-20-10-12-4-5-13(17)8-15(12)18/h2-8,10H,9H2,1H3,(H2,19,21,23)/b20-10- |
| InChIKey | KXBJLWUOECUHDR-JMIUGGIZSA-N |
| XLogP | 3.60 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|