C14H14BrN3OS2 — CID 9176241
1-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 9176241) has the molecular formula C14H14BrN3OS2 and a molecular weight of 384.32 g/mol. Its IUPAC name is 1-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 9176241 |
| Molecular Formula | C14H14BrN3OS2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 1-[(Z)-(4-bromothiophen-2-yl)methylideneamino]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)N/N=C\c2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C14H14BrN3OS2/c1-19-12-4-2-10(3-5-12)7-16-14(20)18-17-8-13-6-11(15)9-21-13/h2-6,8-9H,7H2,1H3,(H2,16,18,20)/b17-8- |
| InChIKey | MZLCKVASDBKFPP-IUXPMGMMSA-N |
| XLogP | 3.52 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|