C16H16BrN3O2S — CID 135731232
1-benzyl-3-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]thiourea (PubChem CID 135731232) has the molecular formula C16H16BrN3O2S and a molecular weight of 394.29 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-benzyl-3-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135731232 |
| Molecular Formula | C16H16BrN3O2S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 1-benzyl-3-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(Br)cc(/C=N/NC(=S)NCc2ccccc2)c1O |
| InChI | InChI=1S/C16H16BrN3O2S/c1-22-14-8-13(17)7-12(15(14)21)10-19-20-16(23)18-9-11-5-3-2-4-6-11/h2-8,10,21H,9H2,1H3,(H2,18,20,23)/b19-10+ |
| InChIKey | CMEOCUGWRWEGNF-VXLYETTFSA-N |
| XLogP | 3.16 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|