C10H13Br2ClN2O — CID 171437254
N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]ethanamine;hydrochloride (PubChem CID 171437254) has the molecular formula C10H13Br2ClN2O and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]ethanamine;hydrochloride.
| Compound Name | N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171437254 |
| Molecular Formula | C10H13Br2ClN2O |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 369.91 |
| IUPAC Name | N-[(E)-(2,4-dibromo-3-methoxyphenyl)methylideneamino]ethanamine;hydrochloride |
| SMILES | CCN/N=C/c1ccc(Br)c(OC)c1Br.Cl |
| InChI | InChI=1S/C10H12Br2N2O.ClH/c1-3-13-14-6-7-4-5-8(11)10(15-2)9(7)12;/h4-6,13H,3H2,1-2H3;1H/b14-6+; |
| InChIKey | KIHKLBSVCBPHST-JSSTZBRYSA-N |
| XLogP | 3.59 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|