C14H13Br2N3O2 — CID 110505661
N-[(E)-(3,5-dibromo-2,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 110505661) has the molecular formula C14H13Br2N3O2 and a molecular weight of 415.09 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(E)-(3,5-dibromo-2,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 110505661 |
| Molecular Formula | C14H13Br2N3O2 |
| Molecular Weight | 415.09 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2,4-dimethoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | COc1c(Br)cc(/C=N/Nc2ccccn2)c(OC)c1Br |
| InChI | InChI=1S/C14H13Br2N3O2/c1-20-13-9(7-10(15)14(21-2)12(13)16)8-18-19-11-5-3-4-6-17-11/h3-8H,1-2H3,(H,17,19)/b18-8+ |
| InChIKey | ULAKJBPEZYCHPU-QGMBQPNBSA-N |
| XLogP | 4.07 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|