C20H17Cl2N3O2 — CID 110842528
N-[[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]pyridin-2-amine (PubChem CID 110842528) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is N-[[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]pyridin-2-amine.
| Compound Name | N-[[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 110842528 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]pyridin-2-amine |
| SMILES | COc1cccc(C=NNc2ccccn2)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c1-26-18-6-4-5-15(12-24-25-19-7-2-3-10-23-19)20(18)27-13-14-8-9-16(21)17(22)11-14/h2-12H,13H2,1H3,(H,23,25) |
| InChIKey | PWOYWAQQWCYQEB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|