C21H18Cl2N2O — CID 110839719
N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-phenylmethanamine (PubChem CID 110839719) has the molecular formula C21H18Cl2N2O and a molecular weight of 385.29 g/mol. Its IUPAC name is N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-phenylmethanamine.
| Compound Name | N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-phenylmethanamine |
|---|---|
| PubChem CID | 110839719 |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-phenylmethanamine |
| SMILES | Clc1ccc(COc2ccc(C=NNCc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O/c22-20-11-8-18(12-21(20)23)15-26-19-9-6-17(7-10-19)14-25-24-13-16-4-2-1-3-5-16/h1-12,14,24H,13,15H2 |
| InChIKey | IFAXZWJLFHSBLN-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|