C8H6ClNOS — CID 70300458
2-chloro-4-methoxythieno[2,3-b]pyridine (PubChem CID 70300458) has the molecular formula C8H6ClNOS and a molecular weight of 199.66 g/mol. Its IUPAC name is 2-chloro-4-methoxythieno[2,3-b]pyridine.
| Compound Name | 2-chloro-4-methoxythieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 70300458 |
| Molecular Formula | C8H6ClNOS |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 2-chloro-4-methoxythieno[2,3-b]pyridine |
| SMILES | COc1ccnc2sc(Cl)cc12 |
| InChI | InChI=1S/C8H6ClNOS/c1-11-6-2-3-10-8-5(6)4-7(9)12-8/h2-4H,1H3 |
| InChIKey | ICUYMZHECANJAE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |