C11H15NOS — CID 143768764
ethane;7-methoxy-2-methylthieno[3,2-b]pyridine (PubChem CID 143768764) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is ethane;7-methoxy-2-methylthieno[3,2-b]pyridine.
| Compound Name | ethane;7-methoxy-2-methylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 143768764 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | ethane;7-methoxy-2-methylthieno[3,2-b]pyridine |
| SMILES | CC.COc1ccnc2cc(C)sc12 |
| InChI | InChI=1S/C9H9NOS.C2H6/c1-6-5-7-9(12-6)8(11-2)3-4-10-7;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | QFJQCHNRIYFVMR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |