C18H23FN2O3S — CID 143652844
ethane;7-(2-fluoro-4-nitrocyclohexa-1,5-dien-1-yl)oxy-2-methylthieno[3,2-b]pyridine (PubChem CID 143652844) has the molecular formula C18H23FN2O3S and a molecular weight of 366.46 g/mol. Its IUPAC name is ethane;7-(2-fluoro-4-nitrocyclohexa-1,5-dien-1-yl)oxy-2-methylthieno[3,2-b]pyridine.
| Compound Name | ethane;7-(2-fluoro-4-nitrocyclohexa-1,5-dien-1-yl)oxy-2-methylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 143652844 |
| Molecular Formula | C18H23FN2O3S |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | ethane;7-(2-fluoro-4-nitrocyclohexa-1,5-dien-1-yl)oxy-2-methylthieno[3,2-b]pyridine |
| SMILES | CC.CC.Cc1cc2nccc(OC3=C(F)CC([N+](=O)[O-])C=C3)c2s1 |
| InChI | InChI=1S/C14H11FN2O3S.2C2H6/c1-8-6-11-14(21-8)13(4-5-16-11)20-12-3-2-9(17(18)19)7-10(12)15;2*1-2/h2-6,9H,7H2,1H3;2*1-2H3 |
| InChIKey | KGRLDZSLSDBXLF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|