C14H13Cl3N2O2 — CID 103172138
2,4,5-trichloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline (PubChem CID 103172138) has the molecular formula C14H13Cl3N2O2 and a molecular weight of 347.63 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline.
| Compound Name | 2,4,5-trichloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 103172138 |
| Molecular Formula | C14H13Cl3N2O2 |
| Molecular Weight | 347.63 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2,4,5-trichloro-N-[(3,4-dimethoxy-2-pyridinyl)methyl]aniline |
| SMILES | COc1ccnc(CNc2cc(Cl)c(Cl)cc2Cl)c1OC |
| InChI | InChI=1S/C14H13Cl3N2O2/c1-20-13-3-4-18-12(14(13)21-2)7-19-11-6-9(16)8(15)5-10(11)17/h3-6,19H,7H2,1-2H3 |
| InChIKey | ATFADJXCMJASAV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|