C10H16FNO2 — CID 163252234
ethane;5-fluoro-2,4-dimethoxy-3-methylpyridine (PubChem CID 163252234) has the molecular formula C10H16FNO2 and a molecular weight of 201.24 g/mol. Its IUPAC name is ethane;5-fluoro-2,4-dimethoxy-3-methylpyridine.
| Compound Name | ethane;5-fluoro-2,4-dimethoxy-3-methylpyridine |
|---|---|
| PubChem CID | 163252234 |
| Molecular Formula | C10H16FNO2 |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | ethane;5-fluoro-2,4-dimethoxy-3-methylpyridine |
| SMILES | CC.COc1ncc(F)c(OC)c1C |
| InChI | InChI=1S/C8H10FNO2.C2H6/c1-5-7(11-2)6(9)4-10-8(5)12-3;1-2/h4H,1-3H3;1-2H3 |
| InChIKey | SSUBHQCDXFNRSU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |