C11H15N3O3 — CID 166534222
ethane;7-methoxy-8-methyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 166534222) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is ethane;7-methoxy-8-methyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | ethane;7-methoxy-8-methyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166534222 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | ethane;7-methoxy-8-methyl-1H-pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | CC.COc1ncc2c(=O)[nH]c(=O)[nH]c2c1C |
| InChI | InChI=1S/C9H9N3O3.C2H6/c1-4-6-5(3-10-8(4)15-2)7(13)12-9(14)11-6;1-2/h3H,1-2H3,(H2,11,12,13,14);1-2H3 |
| InChIKey | SBFLEFVTVUOWQC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |