C9H7ClN4O3S — CID 142642156
12-methoxy-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride (PubChem CID 142642156) has the molecular formula C9H7ClN4O3S and a molecular weight of 286.70 g/mol. Its IUPAC name is 12-methoxy-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride.
| Compound Name | 12-methoxy-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride |
|---|---|
| PubChem CID | 142642156 |
| Molecular Formula | C9H7ClN4O3S |
| Molecular Weight | 286.70 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 12-methoxy-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,6-dione;hydrochloride |
| SMILES | COc1cnc2sc3c(=O)[nH]c(=O)[nH]c3c2n1.Cl |
| InChI | InChI=1S/C9H6N4O3S.ClH/c1-16-3-2-10-8-5(11-3)4-6(17-8)7(14)13-9(15)12-4;/h2H,1H3,(H2,12,13,14,15);1H |
| InChIKey | RMWBRIPBCBEVSK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.70 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |