C18H12F3N3O4S — CID 176994817
11-(2,4-dimethoxyphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione (PubChem CID 176994817) has the molecular formula C18H12F3N3O4S and a molecular weight of 423.37 g/mol. Its IUPAC name is 11-(2,4-dimethoxyphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione.
| Compound Name | 11-(2,4-dimethoxyphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
|---|---|
| PubChem CID | 176994817 |
| Molecular Formula | C18H12F3N3O4S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 11-(2,4-dimethoxyphenyl)-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)c3c(n2)sc2c(=O)[nH]c(=O)[nH]c23)c(OC)c1 |
| InChI | InChI=1S/C18H12F3N3O4S/c1-27-7-3-4-8(11(5-7)28-2)10-6-9(18(19,20)21)12-13-14(29-16(12)22-10)15(25)24-17(26)23-13/h3-6H,1-2H3,(H2,23,24,25,26) |
| InChIKey | JPELLJRTSGJWFT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |