C12H11FN2O3 — CID 106516713
6-(2,4-dimethoxyphenyl)-5-fluoro-1H-pyrimidin-2-one (PubChem CID 106516713) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 6-(2,4-dimethoxyphenyl)-5-fluoro-1H-pyrimidin-2-one.
| Compound Name | 6-(2,4-dimethoxyphenyl)-5-fluoro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 106516713 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 6-(2,4-dimethoxyphenyl)-5-fluoro-1H-pyrimidin-2-one |
| SMILES | COc1ccc(-c2[nH]c(=O)ncc2F)c(OC)c1 |
| InChI | InChI=1S/C12H11FN2O3/c1-17-7-3-4-8(10(5-7)18-2)11-9(13)6-14-12(16)15-11/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | CZCXUIBSRDZERE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |