C14H10Cl2N4O2S — CID 142642104
12-pyridin-3-yl-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione;dihydrochloride (PubChem CID 142642104) has the molecular formula C14H10Cl2N4O2S and a molecular weight of 369.23 g/mol. Its IUPAC name is 12-pyridin-3-yl-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione;dihydrochloride.
| Compound Name | 12-pyridin-3-yl-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione;dihydrochloride |
|---|---|
| PubChem CID | 142642104 |
| Molecular Formula | C14H10Cl2N4O2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 12-pyridin-3-yl-8-thia-3,5,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione;dihydrochloride |
| SMILES | Cl.Cl.O=c1[nH]c(=O)c2sc3ccc(-c4cccnc4)nc3c2[nH]1 |
| InChI | InChI=1S/C14H8N4O2S.2ClH/c19-13-12-11(17-14(20)18-13)10-9(21-12)4-3-8(16-10)7-2-1-5-15-6-7;;/h1-6H,(H2,17,18,19,20);2*1H |
| InChIKey | OAKMGCZBASPDPT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |