C13H9N3 — CID 151981661
2-pyridin-3-yl-1,5-naphthyridine (PubChem CID 151981661) has the molecular formula C13H9N3 and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-pyridin-3-yl-1,5-naphthyridine.
| Compound Name | 2-pyridin-3-yl-1,5-naphthyridine |
|---|---|
| PubChem CID | 151981661 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-pyridin-3-yl-1,5-naphthyridine |
| SMILES | c1cncc(-c2ccc3ncccc3n2)c1 |
| InChI | InChI=1S/C13H9N3/c1-3-10(9-14-7-1)11-5-6-12-13(16-11)4-2-8-15-12/h1-9H |
| InChIKey | UCUOTWVKBZBCIU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |