C7H5N3OS — CID 70007227
4-pyridin-3-yl-1,2,5-thiadiazol-3-one (PubChem CID 70007227) has the molecular formula C7H5N3OS and a molecular weight of 179.20 g/mol. Its IUPAC name is 4-pyridin-3-yl-1,2,5-thiadiazol-3-one.
| Compound Name | 4-pyridin-3-yl-1,2,5-thiadiazol-3-one |
|---|---|
| PubChem CID | 70007227 |
| Molecular Formula | C7H5N3OS |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 4-pyridin-3-yl-1,2,5-thiadiazol-3-one |
| SMILES | O=c1[nH]snc1-c1cccnc1 |
| InChI | InChI=1S/C7H5N3OS/c11-7-6(9-12-10-7)5-2-1-3-8-4-5/h1-4H,(H,10,11) |
| InChIKey | HGHMNWJAHYFKEU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |