About 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine
3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine (PubChem CID 160628601) has the molecular formula C12H9ClN4S
and a molecular weight of 276.75 g/mol. Its IUPAC name is 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine.
Molecular Properties
| Compound Name | 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine |
| PubChem CID | 160628601 |
| Molecular Formula | C12H9ClN4S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine |
| SMILES | Clc1nsnc1-c1cccnc1.c1ccncc1 |
| InChI | InChI=1S/C7H4ClN3S.C5H5N/c8-7-6(10-12-11-7)5-2-1-3-9-4-5;1-2-4-6-5-3-1/h1-4H;1-5H |
| InChIKey | RHQALZROIVUTDV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine?
The IUPAC name of 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine (CID 160628601) is 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine.
What is the SMILES notation for 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine?
The canonical SMILES for 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine is Clc1nsnc1-c1cccnc1.c1ccncc1.
What is the InChIKey of 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine?
The InChIKey is RHQALZROIVUTDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3S.C5H5N/c8-7-6(10-12-11-7)5-2-1-3-9-4-5;1-2-4-6-5-3-1/h1-4H;1-5H.
What are the key properties of 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine?
3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine has a molecular weight of 276.75 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-pyridin-3-yl-1,2,5-thiadiazole;pyridine is sourced from PubChem (CID 160628601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).