C11H11N3OS — CID 139697051
3-but-1-enoxy-4-pyridin-3-yl-1,2,5-thiadiazole (PubChem CID 139697051) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 3-but-1-enoxy-4-pyridin-3-yl-1,2,5-thiadiazole.
| Compound Name | 3-but-1-enoxy-4-pyridin-3-yl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 139697051 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 3-but-1-enoxy-4-pyridin-3-yl-1,2,5-thiadiazole |
| SMILES | CCC=COc1nsnc1-c1cccnc1 |
| InChI | InChI=1S/C11H11N3OS/c1-2-3-7-15-11-10(13-16-14-11)9-5-4-6-12-8-9/h3-8H,2H2,1H3 |
| InChIKey | PIBPPWCTCHVSCN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|