C13H15N3OS — CID 19075354
3-[(E)-hex-4-enoxy]-4-pyridin-3-yl-1,2,5-thiadiazole (PubChem CID 19075354) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-[(E)-hex-4-enoxy]-4-pyridin-3-yl-1,2,5-thiadiazole.
| Compound Name | 3-[(E)-hex-4-enoxy]-4-pyridin-3-yl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 19075354 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-[(E)-hex-4-enoxy]-4-pyridin-3-yl-1,2,5-thiadiazole |
| SMILES | C/C=C/CCCOc1nsnc1-c1cccnc1 |
| InChI | InChI=1S/C13H15N3OS/c1-2-3-4-5-9-17-13-12(15-18-16-13)11-7-6-8-14-10-11/h2-3,6-8,10H,4-5,9H2,1H3/b3-2+ |
| InChIKey | PKMWXDYEECJVPU-NSCUHMNNSA-N |
| XLogP | 3.34 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|