C14H19N3OS — CID 175403000
3-hexoxy-4-(2-methyl-3-pyridinyl)-1,2,5-thiadiazole (PubChem CID 175403000) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-hexoxy-4-(2-methyl-3-pyridinyl)-1,2,5-thiadiazole.
| Compound Name | 3-hexoxy-4-(2-methyl-3-pyridinyl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 175403000 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-hexoxy-4-(2-methyl-3-pyridinyl)-1,2,5-thiadiazole |
| SMILES | CCCCCCOc1nsnc1-c1cccnc1C |
| InChI | InChI=1S/C14H19N3OS/c1-3-4-5-6-10-18-14-13(16-19-17-14)12-8-7-9-15-11(12)2/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | AEPXCESDKIZDRN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|