C20H29N4OS+ — CID 172567344
3-hexoxy-4-[1-methyl-1-(pyridin-3-ylmethyl)-3,6-dihydro-2H-pyridin-1-ium-5-yl]-1,2,5-thiadiazole (PubChem CID 172567344) has the molecular formula C20H29N4OS+ and a molecular weight of 373.55 g/mol. Its IUPAC name is 3-hexoxy-4-[1-methyl-1-(pyridin-3-ylmethyl)-3,6-dihydro-2H-pyridin-1-ium-5-yl]-1,2,5-thiadiazole.
| Compound Name | 3-hexoxy-4-[1-methyl-1-(pyridin-3-ylmethyl)-3,6-dihydro-2H-pyridin-1-ium-5-yl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 172567344 |
| Molecular Formula | C20H29N4OS+ |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 3-hexoxy-4-[1-methyl-1-(pyridin-3-ylmethyl)-3,6-dihydro-2H-pyridin-1-ium-5-yl]-1,2,5-thiadiazole |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(Cc2cccnc2)C1 |
| InChI | InChI=1S/C20H29N4OS/c1-3-4-5-6-13-25-20-19(22-26-23-20)18-10-8-12-24(2,16-18)15-17-9-7-11-21-14-17/h7,9-11,14H,3-6,8,12-13,15-16H2,1-2H3/q+1 |
| InChIKey | XHQALBXBWAKUPW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|