C18H28N3O7S+ — CID 57000720
2-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2,3-dihydroxybutanedioic acid (PubChem CID 57000720) has the molecular formula C18H28N3O7S+ and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2,3-dihydroxybutanedioic acid.
| Compound Name | 2-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 57000720 |
| Molecular Formula | C18H28N3O7S+ |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2,3-dihydroxybutanedioic acid |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(C(O)(C(=O)O)C(O)C(=O)O)C1 |
| InChI | InChI=1S/C18H27N3O7S/c1-3-4-5-6-10-28-15-13(19-29-20-15)12-8-7-9-21(2,11-12)18(27,17(25)26)14(22)16(23)24/h8,14,22,27H,3-7,9-11H2,1-2H3,(H-,23,24,25,26)/p+1 |
| InChIKey | JAJAXKDFYOUFLI-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 150.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|