C30H56N3O5S+ — CID 177225985
1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl propan-2-yl carbonate;methoxymethane (PubChem CID 177225985) has the molecular formula C30H56N3O5S+ and a molecular weight of 570.86 g/mol. Its IUPAC name is 1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl propan-2-yl carbonate;methoxymethane.
| Compound Name | 1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl propan-2-yl carbonate;methoxymethane |
|---|---|
| PubChem CID | 177225985 |
| Molecular Formula | C30H56N3O5S+ |
| Molecular Weight | 570.86 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | 1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl propan-2-yl carbonate;methoxymethane |
| SMILES | CCCCCCCCCC(OC(=O)OC(C)C)[N+]1(C)CCC=C(c2nsnc2OCCCCCC)C1.COC |
| InChI | InChI=1S/C28H50N3O4S.C2H6O/c1-6-8-10-12-13-14-15-19-25(35-28(32)34-23(3)4)31(5)20-17-18-24(22-31)26-27(30-36-29-26)33-21-16-11-9-7-2;1-3-2/h18,23,25H,6-17,19-22H2,1-5H3;1-2H3/q+1; |
| InChIKey | NDICZHIOGVTUPK-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.86 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|