C23H40IN3O4S — CID 172566970
butyl [1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2-methylpropyl] carbonate iodide (PubChem CID 172566970) has the molecular formula C23H40IN3O4S and a molecular weight of 581.56 g/mol. Its IUPAC name is butyl [1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2-methylpropyl] carbonate iodide.
| Compound Name | butyl [1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2-methylpropyl] carbonate iodide |
|---|---|
| PubChem CID | 172566970 |
| Molecular Formula | C23H40IN3O4S |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | butyl [1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]-2-methylpropyl] carbonate iodide |
| SMILES | CCCCCCOc1nsnc1C1=CCC[N+](C)(C(OC(=O)OCCCC)C(C)C)C1.[I-] |
| InChI | InChI=1S/C23H40N3O4S.HI/c1-6-8-10-11-16-28-21-20(24-31-25-21)19-13-12-14-26(5,17-19)22(18(3)4)30-23(27)29-15-9-7-2;/h13,18,22H,6-12,14-17H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | GAZARDGQJRVBOU-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|