C29H52IN3O3S — CID 172566949
1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl 3-methylbutanoate iodide (PubChem CID 172566949) has the molecular formula C29H52IN3O3S and a molecular weight of 649.72 g/mol. Its IUPAC name is 1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl 3-methylbutanoate iodide.
| Compound Name | 1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl 3-methylbutanoate iodide |
|---|---|
| PubChem CID | 172566949 |
| Molecular Formula | C29H52IN3O3S |
| Molecular Weight | 649.72 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | 1-[5-(4-hexoxy-1,2,5-thiadiazol-3-yl)-1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl]decyl 3-methylbutanoate iodide |
| SMILES | CCCCCCCCCC(OC(=O)CC(C)C)[N+]1(C)CCC=C(c2nsnc2OCCCCCC)C1.[I-] |
| InChI | InChI=1S/C29H52N3O3S.HI/c1-6-8-10-12-13-14-15-19-26(35-27(33)22-24(3)4)32(5)20-17-18-25(23-32)28-29(31-36-30-28)34-21-16-11-9-7-2;/h18,24,26H,6-17,19-23H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | GUOKUBMIZSNYEI-UHFFFAOYSA-M |
| XLogP | 4.79 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|